About 3-ethyl-1-methyl-1,4-diazepane;dihydrochloride
3-ethyl-1-methyl-1,4-diazepane;dihydrochloride (PubChem CID 91647799) has the molecular formula C8H20Cl2N2
and a molecular weight of 215.17 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1,4-diazepane;dihydrochloride.
Molecular Properties
| Compound Name | 3-ethyl-1-methyl-1,4-diazepane;dihydrochloride |
| PubChem CID | 91647799 |
| Molecular Formula | C8H20Cl2N2 |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 3-ethyl-1-methyl-1,4-diazepane;dihydrochloride |
| SMILES | CCC1CN(C)CCCN1.Cl.Cl |
| InChI | InChI=1S/C8H18N2.2ClH/c1-3-8-7-10(2)6-4-5-9-8;;/h8-9H,3-7H2,1-2H3;2*1H |
| InChIKey | HXPPRASVEAPYEO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-1-methyl-1,4-diazepane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-methyl-1,4-diazepane;dihydrochloride?
The IUPAC name of 3-ethyl-1-methyl-1,4-diazepane;dihydrochloride (CID 91647799) is 3-ethyl-1-methyl-1,4-diazepane;dihydrochloride.
What is the SMILES notation for 3-ethyl-1-methyl-1,4-diazepane;dihydrochloride?
The canonical SMILES for 3-ethyl-1-methyl-1,4-diazepane;dihydrochloride is CCC1CN(C)CCCN1.Cl.Cl.
What is the InChIKey of 3-ethyl-1-methyl-1,4-diazepane;dihydrochloride?
The InChIKey is HXPPRASVEAPYEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2.2ClH/c1-3-8-7-10(2)6-4-5-9-8;;/h8-9H,3-7H2,1-2H3;2*1H.
What are the key properties of 3-ethyl-1-methyl-1,4-diazepane;dihydrochloride?
3-ethyl-1-methyl-1,4-diazepane;dihydrochloride has a molecular weight of 215.17 g/mol, XLogP of 1.53, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-methyl-1,4-diazepane;dihydrochloride is sourced from PubChem (CID 91647799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).