About 2-ethylazepan-4-one
2-ethylazepan-4-one (PubChem CID 70067694) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is 2-ethylazepan-4-one.
Molecular Properties
| Compound Name | 2-ethylazepan-4-one |
| PubChem CID | 70067694 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 2-ethylazepan-4-one |
| SMILES | CCC1CC(=O)CCCN1 |
| InChI | InChI=1S/C8H15NO/c1-2-7-6-8(10)4-3-5-9-7/h7,9H,2-6H2,1H3 |
| InChIKey | QMPFLOVBFFSMBR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylazepan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylazepan-4-one?
The IUPAC name of 2-ethylazepan-4-one (CID 70067694) is 2-ethylazepan-4-one.
What is the SMILES notation for 2-ethylazepan-4-one?
The canonical SMILES for 2-ethylazepan-4-one is CCC1CC(=O)CCCN1.
What is the InChIKey of 2-ethylazepan-4-one?
The InChIKey is QMPFLOVBFFSMBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO/c1-2-7-6-8(10)4-3-5-9-7/h7,9H,2-6H2,1H3.
What are the key properties of 2-ethylazepan-4-one?
2-ethylazepan-4-one has a molecular weight of 141.21 g/mol, XLogP of 1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylazepan-4-one is sourced from PubChem (CID 70067694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).