C6H12N2O — CID 71303953
6-ethyl-1,3-diazinan-4-one (PubChem CID 71303953) has the molecular formula C6H12N2O and a molecular weight of 128.18 g/mol. Its IUPAC name is 6-ethyl-1,3-diazinan-4-one.
| Compound Name | 6-ethyl-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 71303953 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 6-ethyl-1,3-diazinan-4-one |
| SMILES | CCC1CC(=O)NCN1 |
| InChI | InChI=1S/C6H12N2O/c1-2-5-3-6(9)8-4-7-5/h5,7H,2-4H2,1H3,(H,8,9) |
| InChIKey | CTMZQLQXZRRQSM-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |