C8H14N2O3 — CID 105442020
7-ethyl-5-oxo-1,4-diazepane-2-carboxylic acid (PubChem CID 105442020) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is 7-ethyl-5-oxo-1,4-diazepane-2-carboxylic acid.
| Compound Name | 7-ethyl-5-oxo-1,4-diazepane-2-carboxylic acid |
|---|---|
| PubChem CID | 105442020 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 7-ethyl-5-oxo-1,4-diazepane-2-carboxylic acid |
| SMILES | CCC1CC(=O)NCC(C(=O)O)N1 |
| InChI | InChI=1S/C8H14N2O3/c1-2-5-3-7(11)9-4-6(10-5)8(12)13/h5-6,10H,2-4H2,1H3,(H,9,11)(H,12,13) |
| InChIKey | ZLSKVOJRUTZZEC-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |