C13H23N3O2 — CID 83192198
4-(2,5-diethylpiperazine-1-carbonyl)pyrrolidin-2-one (PubChem CID 83192198) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 4-(2,5-diethylpiperazine-1-carbonyl)pyrrolidin-2-one.
| Compound Name | 4-(2,5-diethylpiperazine-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 83192198 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 4-(2,5-diethylpiperazine-1-carbonyl)pyrrolidin-2-one |
| SMILES | CCC1CN(C(=O)C2CNC(=O)C2)C(CC)CN1 |
| InChI | InChI=1S/C13H23N3O2/c1-3-10-8-16(11(4-2)7-14-10)13(18)9-5-12(17)15-6-9/h9-11,14H,3-8H2,1-2H3,(H,15,17) |
| InChIKey | WASHWXOJTOTPNR-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |