C16H30N2O — CID 64978349
2-cyclohexyl-1-(2,5-diethylpiperazin-1-yl)ethanone (PubChem CID 64978349) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 2-cyclohexyl-1-(2,5-diethylpiperazin-1-yl)ethanone.
| Compound Name | 2-cyclohexyl-1-(2,5-diethylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 64978349 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 2-cyclohexyl-1-(2,5-diethylpiperazin-1-yl)ethanone |
| SMILES | CCC1CN(C(=O)CC2CCCCC2)C(CC)CN1 |
| InChI | InChI=1S/C16H30N2O/c1-3-14-12-18(15(4-2)11-17-14)16(19)10-13-8-6-5-7-9-13/h13-15,17H,3-12H2,1-2H3 |
| InChIKey | WCGVDECPBBCHJM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |