C13H20F3N3O2 — CID 138713262
1-[(8aS)-8-pyrrolidin-1-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,4-b]pyrazin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 138713262) has the molecular formula C13H20F3N3O2 and a molecular weight of 307.32 g/mol. Its IUPAC name is 1-[(8aS)-8-pyrrolidin-1-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,4-b]pyrazin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(8aS)-8-pyrrolidin-1-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,4-b]pyrazin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 138713262 |
| Molecular Formula | C13H20F3N3O2 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 1-[(8aS)-8-pyrrolidin-1-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,4-b]pyrazin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(N1CCNC2COCC(N3CCCC3)[C@H]21)C(F)(F)F |
| InChI | InChI=1S/C13H20F3N3O2/c14-13(15,16)12(20)19-6-3-17-9-7-21-8-10(11(9)19)18-4-1-2-5-18/h9-11,17H,1-8H2/t9?,10?,11-/m0/s1 |
| InChIKey | YJKLLACOMQDZRI-ILDUYXDCSA-N |
| XLogP | 0.21 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |