About 3-thia-6,9-diazabicyclo[6.2.0]decane
3-thia-6,9-diazabicyclo[6.2.0]decane (PubChem CID 118210384) has the molecular formula C7H14N2S
and a molecular weight of 158.27 g/mol. Its IUPAC name is 3-thia-6,9-diazabicyclo[6.2.0]decane.
Molecular Properties
| Compound Name | 3-thia-6,9-diazabicyclo[6.2.0]decane |
| PubChem CID | 118210384 |
| Molecular Formula | C7H14N2S |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 3-thia-6,9-diazabicyclo[6.2.0]decane |
| SMILES | C1CSCC2CNC2CN1 |
| InChI | InChI=1S/C7H14N2S/c1-2-10-5-6-3-9-7(6)4-8-1/h6-9H,1-5H2 |
| InChIKey | AANUHMFVOOMVJA-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-thia-6,9-diazabicyclo[6.2.0]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thia-6,9-diazabicyclo[6.2.0]decane?
The IUPAC name of 3-thia-6,9-diazabicyclo[6.2.0]decane (CID 118210384) is 3-thia-6,9-diazabicyclo[6.2.0]decane.
What is the SMILES notation for 3-thia-6,9-diazabicyclo[6.2.0]decane?
The canonical SMILES for 3-thia-6,9-diazabicyclo[6.2.0]decane is C1CSCC2CNC2CN1.
What is the InChIKey of 3-thia-6,9-diazabicyclo[6.2.0]decane?
The InChIKey is AANUHMFVOOMVJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2S/c1-2-10-5-6-3-9-7(6)4-8-1/h6-9H,1-5H2.
What are the key properties of 3-thia-6,9-diazabicyclo[6.2.0]decane?
3-thia-6,9-diazabicyclo[6.2.0]decane has a molecular weight of 158.27 g/mol, XLogP of -0.09, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thia-6,9-diazabicyclo[6.2.0]decane is sourced from PubChem (CID 118210384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).