About 4-(thian-3-yl)piperidine
4-(thian-3-yl)piperidine (PubChem CID 82602229) has the molecular formula C10H19NS
and a molecular weight of 185.34 g/mol. Its IUPAC name is 4-(thian-3-yl)piperidine.
Molecular Properties
| Compound Name | 4-(thian-3-yl)piperidine |
| PubChem CID | 82602229 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 4-(thian-3-yl)piperidine |
| SMILES | C1CSCC(C2CCNCC2)C1 |
| InChI | InChI=1S/C10H19NS/c1-2-10(8-12-7-1)9-3-5-11-6-4-9/h9-11H,1-8H2 |
| InChIKey | WCZBPNZRECAVIR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(thian-3-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(thian-3-yl)piperidine?
The IUPAC name of 4-(thian-3-yl)piperidine (CID 82602229) is 4-(thian-3-yl)piperidine.
What is the SMILES notation for 4-(thian-3-yl)piperidine?
The canonical SMILES for 4-(thian-3-yl)piperidine is C1CSCC(C2CCNCC2)C1.
What is the InChIKey of 4-(thian-3-yl)piperidine?
The InChIKey is WCZBPNZRECAVIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NS/c1-2-10(8-12-7-1)9-3-5-11-6-4-9/h9-11H,1-8H2.
What are the key properties of 4-(thian-3-yl)piperidine?
4-(thian-3-yl)piperidine has a molecular weight of 185.34 g/mol, XLogP of 2.13, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(thian-3-yl)piperidine is sourced from PubChem (CID 82602229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).