About 3-cyclopropylthiane
3-cyclopropylthiane (PubChem CID 57306935) has the molecular formula C8H14S
and a molecular weight of 142.27 g/mol. Its IUPAC name is 3-cyclopropylthiane.
Molecular Properties
| Compound Name | 3-cyclopropylthiane |
| PubChem CID | 57306935 |
| Molecular Formula | C8H14S |
| Molecular Weight | 142.27 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | 3-cyclopropylthiane |
| SMILES | C1CSCC(C2CC2)C1 |
| InChI | InChI=1S/C8H14S/c1-2-8(6-9-5-1)7-3-4-7/h7-8H,1-6H2 |
| InChIKey | XOWZTYLEVPLHQE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclopropylthiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropylthiane?
The IUPAC name of 3-cyclopropylthiane (CID 57306935) is 3-cyclopropylthiane.
What is the SMILES notation for 3-cyclopropylthiane?
The canonical SMILES for 3-cyclopropylthiane is C1CSCC(C2CC2)C1.
What is the InChIKey of 3-cyclopropylthiane?
The InChIKey is XOWZTYLEVPLHQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14S/c1-2-8(6-9-5-1)7-3-4-7/h7-8H,1-6H2.
What are the key properties of 3-cyclopropylthiane?
3-cyclopropylthiane has a molecular weight of 142.27 g/mol, XLogP of 2.54, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropylthiane is sourced from PubChem (CID 57306935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).