C11H16O2S — CID 141019726
2-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-one (PubChem CID 141019726) has the molecular formula C11H16O2S and a molecular weight of 212.31 g/mol. Its IUPAC name is 2-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-one.
| Compound Name | 2-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 141019726 |
| Molecular Formula | C11H16O2S |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-one |
| SMILES | O=C1CC(C2CCCSC2)CC=C1O |
| InChI | InChI=1S/C11H16O2S/c12-10-4-3-8(6-11(10)13)9-2-1-5-14-7-9/h4,8-9,12H,1-3,5-7H2 |
| InChIKey | MPCRIAYJHKQKLP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |