C19H24ClNO3S2 — CID 135789545
2-[(Z)-N-[(5-chlorothiophen-2-yl)methoxy]-C-ethylcarbonimidoyl]-3-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-one (PubChem CID 135789545) has the molecular formula C19H24ClNO3S2 and a molecular weight of 413.99 g/mol. Its IUPAC name is 2-[(Z)-N-[(5-chlorothiophen-2-yl)methoxy]-C-ethylcarbonimidoyl]-3-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-one.
| Compound Name | 2-[(Z)-N-[(5-chlorothiophen-2-yl)methoxy]-C-ethylcarbonimidoyl]-3-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135789545 |
| Molecular Formula | C19H24ClNO3S2 |
| Molecular Weight | 413.99 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 2-[(Z)-N-[(5-chlorothiophen-2-yl)methoxy]-C-ethylcarbonimidoyl]-3-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-one |
| SMILES | CC/C(=N/OCc1ccc(Cl)s1)C1=C(O)CC(C2CCCSC2)CC1=O |
| InChI | InChI=1S/C19H24ClNO3S2/c1-2-15(21-24-10-14-5-6-18(20)26-14)19-16(22)8-13(9-17(19)23)12-4-3-7-25-11-12/h5-6,12-13,22H,2-4,7-11H2,1H3/b21-15- |
| InChIKey | KAXAFQUEDITBDN-QNGOZBTKSA-N |
| XLogP | 5.62 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.99 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|