C10H19NOS — CID 117228790
5,5-dimethyl-2-(thian-3-yl)-1,3-oxazolidine (PubChem CID 117228790) has the molecular formula C10H19NOS and a molecular weight of 201.33 g/mol. Its IUPAC name is 5,5-dimethyl-2-(thian-3-yl)-1,3-oxazolidine.
| Compound Name | 5,5-dimethyl-2-(thian-3-yl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 117228790 |
| Molecular Formula | C10H19NOS |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 5,5-dimethyl-2-(thian-3-yl)-1,3-oxazolidine |
| SMILES | CC1(C)CNC(C2CCCSC2)O1 |
| InChI | InChI=1S/C10H19NOS/c1-10(2)7-11-9(12-10)8-4-3-5-13-6-8/h8-9,11H,3-7H2,1-2H3 |
| InChIKey | XGJWIBLUPFDISD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |