C14H24O2 — CID 10727868
(1S,10E,12R)-2,13-dioxabicyclo[10.4.0]hexadec-10-ene (PubChem CID 10727868) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (1S,10E,12R)-2,13-dioxabicyclo[10.4.0]hexadec-10-ene.
| Compound Name | (1S,10E,12R)-2,13-dioxabicyclo[10.4.0]hexadec-10-ene |
|---|---|
| PubChem CID | 10727868 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (1S,10E,12R)-2,13-dioxabicyclo[10.4.0]hexadec-10-ene |
| SMILES | C1=C/[C@H]2OCCC[C@@H]2OCCCCCCC/1 |
| InChI | InChI=1S/C14H24O2/c1-2-4-6-9-13-14(10-8-12-16-13)15-11-7-5-3-1/h6,9,13-14H,1-5,7-8,10-12H2/b9-6+/t13-,14+/m1/s1 |
| InChIKey | QDSJZAMPDUDRJP-VVYAQTJFSA-N |
| XLogP | 3.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|