C17H26O3 — CID 23567726
(2Z,14Z)-17,19-dioxabicyclo[14.3.0]nonadeca-2,14-dien-18-one (PubChem CID 23567726) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (2Z,14Z)-17,19-dioxabicyclo[14.3.0]nonadeca-2,14-dien-18-one.
| Compound Name | (2Z,14Z)-17,19-dioxabicyclo[14.3.0]nonadeca-2,14-dien-18-one |
|---|---|
| PubChem CID | 23567726 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (2Z,14Z)-17,19-dioxabicyclo[14.3.0]nonadeca-2,14-dien-18-one |
| SMILES | O=C1OC2/C=C\CCCCCCCCCC/C=C\C2O1 |
| InChI | InChI=1S/C17H26O3/c18-17-19-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(15)20-17/h11-16H,1-10H2/b13-11-,14-12- |
| InChIKey | AWJITBGDPMEDCH-XSYHWHKQSA-N |
| XLogP | 4.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|