C18H28O2 — CID 177410981
(1S,9E,15R)-18-methylidene-16-oxabicyclo[13.3.0]octadec-9-en-17-one (PubChem CID 177410981) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is (1S,9E,15R)-18-methylidene-16-oxabicyclo[13.3.0]octadec-9-en-17-one.
| Compound Name | (1S,9E,15R)-18-methylidene-16-oxabicyclo[13.3.0]octadec-9-en-17-one |
|---|---|
| PubChem CID | 177410981 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (1S,9E,15R)-18-methylidene-16-oxabicyclo[13.3.0]octadec-9-en-17-one |
| SMILES | C=C1C(=O)O[C@@H]2CCCC/C=C/CCCCCCC[C@@H]12 |
| InChI | InChI=1S/C18H28O2/c1-15-16-13-11-9-7-5-3-2-4-6-8-10-12-14-17(16)20-18(15)19/h4,6,16-17H,1-3,5,7-14H2/b6-4+/t16-,17+/m0/s1 |
| InChIKey | XOFXIPKWNZBMJR-JSYWMUGDSA-N |
| XLogP | 4.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|