C8H9IO2 — CID 11780361
(3E,3aS,6aS)-3-(iodomethylidene)-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-one (PubChem CID 11780361) has the molecular formula C8H9IO2 and a molecular weight of 264.06 g/mol. Its IUPAC name is (3E,3aS,6aS)-3-(iodomethylidene)-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-one.
| Compound Name | (3E,3aS,6aS)-3-(iodomethylidene)-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 11780361 |
| Molecular Formula | C8H9IO2 |
| Molecular Weight | 264.06 g/mol |
| Exact Mass | 263.96 |
| IUPAC Name | (3E,3aS,6aS)-3-(iodomethylidene)-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-one |
| SMILES | O=C1O[C@H]2CCC[C@H]2/C1=C\I |
| InChI | InChI=1S/C8H9IO2/c9-4-6-5-2-1-3-7(5)11-8(6)10/h4-5,7H,1-3H2/b6-4+/t5-,7-/m0/s1 |
| InChIKey | UCGPWZGPYXARKX-PBFHFMIUSA-N |
| XLogP | 2.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.06 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|