C11H16O2 — CID 10352283
(1R,2S,5R,6S)-10-oxatricyclo[4.3.2.12,5]dodecan-11-one (PubChem CID 10352283) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (1R,2S,5R,6S)-10-oxatricyclo[4.3.2.12,5]dodecan-11-one.
| Compound Name | (1R,2S,5R,6S)-10-oxatricyclo[4.3.2.12,5]dodecan-11-one |
|---|---|
| PubChem CID | 10352283 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (1R,2S,5R,6S)-10-oxatricyclo[4.3.2.12,5]dodecan-11-one |
| SMILES | O=C1O[C@@H]2CCC[C@H]1[C@@H]1CC[C@H]2C1 |
| InChI | InChI=1S/C11H16O2/c12-11-9-2-1-3-10(13-11)8-5-4-7(9)6-8/h7-10H,1-6H2/t7-,8+,9+,10-/m1/s1 |
| InChIKey | OTGWLZZCPMNMMB-XFWSIPNHSA-N |
| XLogP | 2.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |