C10H14O2 — CID 101453700
(1S,2S,6R,7R)-8-oxatricyclo[5.2.2.02,6]undecan-9-one (PubChem CID 101453700) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (1S,2S,6R,7R)-8-oxatricyclo[5.2.2.02,6]undecan-9-one.
| Compound Name | (1S,2S,6R,7R)-8-oxatricyclo[5.2.2.02,6]undecan-9-one |
|---|---|
| PubChem CID | 101453700 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (1S,2S,6R,7R)-8-oxatricyclo[5.2.2.02,6]undecan-9-one |
| SMILES | O=C1O[C@@H]2CC[C@H]1[C@H]1CCC[C@H]12 |
| InChI | InChI=1S/C10H14O2/c11-10-8-4-5-9(12-10)7-3-1-2-6(7)8/h6-9H,1-5H2/t6-,7+,8-,9+/m0/s1 |
| InChIKey | RYHKTNOSGDURBM-UYXSQOIJSA-N |
| XLogP | 1.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |