C9H12CrO — CID 10871164
[(3aS,7aR)-3-methylidene-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-ylidene]chromium (PubChem CID 10871164) has the molecular formula C9H12CrO and a molecular weight of 188.19 g/mol. Its IUPAC name is [(3aS,7aR)-3-methylidene-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-ylidene]chromium.
| Compound Name | [(3aS,7aR)-3-methylidene-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-ylidene]chromium |
|---|---|
| PubChem CID | 10871164 |
| Molecular Formula | C9H12CrO |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | [(3aS,7aR)-3-methylidene-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-ylidene]chromium |
| SMILES | C=C1C(=[Cr])O[C@@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C9H12O.Cr/c1-7-6-10-9-5-3-2-4-8(7)9;/h8-9H,1-5H2;/t8-,9+;/m0./s1 |
| InChIKey | RZBVDZJHZLSBMS-OULXEKPRSA-N |
| XLogP | 1.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |