C13H20O2 — CID 23258288
(4aS,8aR)-2-tert-butyl-4a,5,6,7,8,8a-hexahydrochromen-4-one (PubChem CID 23258288) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (4aS,8aR)-2-tert-butyl-4a,5,6,7,8,8a-hexahydrochromen-4-one.
| Compound Name | (4aS,8aR)-2-tert-butyl-4a,5,6,7,8,8a-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 23258288 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (4aS,8aR)-2-tert-butyl-4a,5,6,7,8,8a-hexahydrochromen-4-one |
| SMILES | CC(C)(C)C1=CC(=O)[C@H]2CCCC[C@H]2O1 |
| InChI | InChI=1S/C13H20O2/c1-13(2,3)12-8-10(14)9-6-4-5-7-11(9)15-12/h8-9,11H,4-7H2,1-3H3/t9-,11-/m1/s1 |
| InChIKey | RZUPSGBAWLBBRL-MWLCHTKSSA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |