C20H28O10 — CID 13402502
(1R,9S,14S,22R)-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosane-3,7,16,20-tetrone (PubChem CID 13402502) has the molecular formula C20H28O10 and a molecular weight of 428.43 g/mol. Its IUPAC name is (1R,9S,14S,22R)-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosane-3,7,16,20-tetrone.
| Compound Name | (1R,9S,14S,22R)-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosane-3,7,16,20-tetrone |
|---|---|
| PubChem CID | 13402502 |
| Molecular Formula | C20H28O10 |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | (1R,9S,14S,22R)-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosane-3,7,16,20-tetrone |
| SMILES | O=C1COCC(=O)O[C@@H]2CCCC[C@H]2OC(=O)COCC(=O)O[C@H]2CCCC[C@@H]2O1 |
| InChI | InChI=1S/C20H28O10/c21-17-9-25-11-19(23)29-15-7-3-4-8-16(15)30-20(24)12-26-10-18(22)28-14-6-2-1-5-13(14)27-17/h13-16H,1-12H2/t13-,14-,15+,16+ |
| InChIKey | ZROJSOWIZBVMJI-RUPPMWDTSA-N |
| XLogP | 0.83 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|