C12H18O — CID 21249473
(2Z,4Z)-13-oxabicyclo[10.1.0]trideca-2,4-diene (PubChem CID 21249473) has the molecular formula C12H18O and a molecular weight of 178.28 g/mol. Its IUPAC name is (2Z,4Z)-13-oxabicyclo[10.1.0]trideca-2,4-diene.
| Compound Name | (2Z,4Z)-13-oxabicyclo[10.1.0]trideca-2,4-diene |
|---|---|
| PubChem CID | 21249473 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (2Z,4Z)-13-oxabicyclo[10.1.0]trideca-2,4-diene |
| SMILES | C1=C\CCCCCCC2OC2\C=C/1 |
| InChI | InChI=1S/C12H18O/c1-2-4-6-8-10-12-11(13-12)9-7-5-3-1/h3,5,7,9,11-12H,1-2,4,6,8,10H2/b5-3-,9-7- |
| InChIKey | DUJVGZVFHWDDBS-XORISBCWSA-N |
| XLogP | 3.22 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|