C12H18Br2 — CID 67848452
5,6-dibromocyclododeca-1,3-diene (PubChem CID 67848452) has the molecular formula C12H18Br2 and a molecular weight of 322.08 g/mol. Its IUPAC name is 5,6-dibromocyclododeca-1,3-diene.
| Compound Name | 5,6-dibromocyclododeca-1,3-diene |
|---|---|
| PubChem CID | 67848452 |
| Molecular Formula | C12H18Br2 |
| Molecular Weight | 322.08 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 5,6-dibromocyclododeca-1,3-diene |
| SMILES | BrC1C=CC=CCCCCCCC1Br |
| InChI | InChI=1S/C12H18Br2/c13-11-9-7-5-3-1-2-4-6-8-10-12(11)14/h3,5,7,9,11-12H,1-2,4,6,8,10H2 |
| InChIKey | HPHJREGUOJAMET-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.08 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|