C8H12O2 — CID 15329988
(4aR,8aS)-2,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran (PubChem CID 15329988) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is (4aR,8aS)-2,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran.
| Compound Name | (4aR,8aS)-2,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran |
|---|---|
| PubChem CID | 15329988 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (4aR,8aS)-2,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran |
| SMILES | C1=C[C@H]2OCCC[C@@H]2OC1 |
| InChI | InChI=1S/C8H12O2/c1-3-7-8(9-5-1)4-2-6-10-7/h1,3,7-8H,2,4-6H2/t7-,8+/m1/s1 |
| InChIKey | AKJXNBAANCVQPT-SFYZADRCSA-N |
| XLogP | 1.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|