C10H14O2 — CID 132969000
(2S,4aR,8aS)-2-ethenyl-2,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran (PubChem CID 132969000) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (2S,4aR,8aS)-2-ethenyl-2,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran.
| Compound Name | (2S,4aR,8aS)-2-ethenyl-2,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran |
|---|---|
| PubChem CID | 132969000 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (2S,4aR,8aS)-2-ethenyl-2,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran |
| SMILES | C=C[C@H]1C=C[C@H]2OCCC[C@@H]2O1 |
| InChI | InChI=1S/C10H14O2/c1-2-8-5-6-9-10(12-8)4-3-7-11-9/h2,5-6,8-10H,1,3-4,7H2/t8-,9+,10-/m0/s1 |
| InChIKey | UBUIJCXZZZZVCZ-AEJSXWLSSA-N |
| XLogP | 1.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|