C15H24O4 — CID 11807695
(1R,3S,8R,11S,13R,14S)-13-ethenyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-14-ol (PubChem CID 11807695) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (1R,3S,8R,11S,13R,14S)-13-ethenyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-14-ol.
| Compound Name | (1R,3S,8R,11S,13R,14S)-13-ethenyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-14-ol |
|---|---|
| PubChem CID | 11807695 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (1R,3S,8R,11S,13R,14S)-13-ethenyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-14-ol |
| SMILES | C=C[C@H]1O[C@H]2CC[C@H]3OCCC[C@@H]3O[C@@H]2CC[C@@H]1O |
| InChI | InChI=1S/C15H24O4/c1-2-11-10(16)5-6-14-15(18-11)8-7-12-13(19-14)4-3-9-17-12/h2,10-16H,1,3-9H2/t10-,11+,12+,13-,14+,15-/m0/s1 |
| InChIKey | AAJLSXXRQATHEK-MTWVNVMRSA-N |
| XLogP | 1.81 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|