C18H24O3 — CID 23657461
(2R,3S,4aR,8aS)-2-ethenyl-3-(2-phenylethoxy)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran (PubChem CID 23657461) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is (2R,3S,4aR,8aS)-2-ethenyl-3-(2-phenylethoxy)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran.
| Compound Name | (2R,3S,4aR,8aS)-2-ethenyl-3-(2-phenylethoxy)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran |
|---|---|
| PubChem CID | 23657461 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (2R,3S,4aR,8aS)-2-ethenyl-3-(2-phenylethoxy)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran |
| SMILES | C=C[C@H]1O[C@H]2CCCO[C@@H]2C[C@@H]1OCCc1ccccc1 |
| InChI | InChI=1S/C18H24O3/c1-2-15-17(13-18-16(21-15)9-6-11-19-18)20-12-10-14-7-4-3-5-8-14/h2-5,7-8,15-18H,1,6,9-13H2/t15-,16+,17+,18-/m1/s1 |
| InChIKey | MIOJTXBZUMRXEA-VSZNYVQBSA-N |
| XLogP | 3.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|