C12H18O3 — CID 135038138
(3R)-3-[(2R)-2,5-dihydrofuran-2-yl]-1,4-dioxaspiro[4.5]decane (PubChem CID 135038138) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (3R)-3-[(2R)-2,5-dihydrofuran-2-yl]-1,4-dioxaspiro[4.5]decane.
| Compound Name | (3R)-3-[(2R)-2,5-dihydrofuran-2-yl]-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 135038138 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (3R)-3-[(2R)-2,5-dihydrofuran-2-yl]-1,4-dioxaspiro[4.5]decane |
| SMILES | C1=C[C@H]([C@H]2COC3(CCCCC3)O2)OC1 |
| InChI | InChI=1S/C12H18O3/c1-2-6-12(7-3-1)14-9-11(15-12)10-5-4-8-13-10/h4-5,10-11H,1-3,6-9H2/t10-,11-/m1/s1 |
| InChIKey | TYBQKOVSMGLJEL-GHMZBOCLSA-N |
| XLogP | 2.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|