C15H20N2O3 — CID 102131999
1-spiro[4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine-2,1'-cyclohexane]-6-ylimidazole (PubChem CID 102131999) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 1-spiro[4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine-2,1'-cyclohexane]-6-ylimidazole.
| Compound Name | 1-spiro[4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine-2,1'-cyclohexane]-6-ylimidazole |
|---|---|
| PubChem CID | 102131999 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 1-spiro[4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine-2,1'-cyclohexane]-6-ylimidazole |
| SMILES | C1=CC(n2ccnc2)OC2COC3(CCCCC3)OC12 |
| InChI | InChI=1S/C15H20N2O3/c1-2-6-15(7-3-1)18-10-13-12(20-15)4-5-14(19-13)17-9-8-16-11-17/h4-5,8-9,11-14H,1-3,6-7,10H2 |
| InChIKey | JYOBNSFFKLUWOO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|