C17H30O2 — CID 135028450
(14R)-17,19-dioxatricyclo[11.3.2.11,14]nonadecane (PubChem CID 135028450) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is (14R)-17,19-dioxatricyclo[11.3.2.11,14]nonadecane.
| Compound Name | (14R)-17,19-dioxatricyclo[11.3.2.11,14]nonadecane |
|---|---|
| PubChem CID | 135028450 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (14R)-17,19-dioxatricyclo[11.3.2.11,14]nonadecane |
| SMILES | C1CCCCCC2COC3(CCCCC1)CC[C@H]2O3 |
| InChI | InChI=1S/C17H30O2/c1-2-4-6-8-10-15-14-18-17(12-9-7-5-3-1)13-11-16(15)19-17/h15-16H,1-14H2/t15?,16-,17?/m1/s1 |
| InChIKey | VKLYJRJYBMMOLX-AQFXKWCLSA-N |
| XLogP | 4.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |