C19H34O2 — CID 91594454
spiro[1,3-dioxolane-2,8'-bicyclo[14.1.0]heptadecane] (PubChem CID 91594454) has the molecular formula C19H34O2 and a molecular weight of 294.48 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,8'-bicyclo[14.1.0]heptadecane].
| Compound Name | spiro[1,3-dioxolane-2,8'-bicyclo[14.1.0]heptadecane] |
|---|---|
| PubChem CID | 91594454 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | spiro[1,3-dioxolane-2,8'-bicyclo[14.1.0]heptadecane] |
| SMILES | C1CCCC2CC2CCCCCCC2(CCC1)OCCO2 |
| InChI | InChI=1S/C19H34O2/c1-2-6-10-17-16-18(17)11-7-3-5-9-13-19(12-8-4-1)20-14-15-21-19/h17-18H,1-16H2 |
| InChIKey | KILHLZIUNXEKPR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |