About (12E)-1,4-dioxaspiro[4.15]icos-12-ene
(12E)-1,4-dioxaspiro[4.15]icos-12-ene (PubChem CID 11357975) has the molecular formula C18H32O2
and a molecular weight of 280.45 g/mol. Its IUPAC name is (12E)-1,4-dioxaspiro[4.15]icos-12-ene.
Molecular Properties
| Compound Name | (12E)-1,4-dioxaspiro[4.15]icos-12-ene |
| PubChem CID | 11357975 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | (12E)-1,4-dioxaspiro[4.15]icos-12-ene |
| SMILES | C1=C/CCCCCCC2(CCCCCCC/1)OCCO2 |
| InChI | InChI=1S/C18H32O2/c1-2-4-6-8-10-12-14-18(19-16-17-20-18)15-13-11-9-7-5-3-1/h1-2H,3-17H2/b2-1+ |
| InChIKey | RMDCTVVVPROCND-OWOJBTEDSA-N |
| XLogP | 5.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (12E)-1,4-dioxaspiro[4.15]icos-12-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (12E)-1,4-dioxaspiro[4.15]icos-12-ene?
The IUPAC name of (12E)-1,4-dioxaspiro[4.15]icos-12-ene (CID 11357975) is (12E)-1,4-dioxaspiro[4.15]icos-12-ene.
What is the SMILES notation for (12E)-1,4-dioxaspiro[4.15]icos-12-ene?
The canonical SMILES for (12E)-1,4-dioxaspiro[4.15]icos-12-ene is C1=C/CCCCCCC2(CCCCCCC/1)OCCO2.
What is the InChIKey of (12E)-1,4-dioxaspiro[4.15]icos-12-ene?
The InChIKey is RMDCTVVVPROCND-OWOJBTEDSA-N. The full InChI is InChI=1S/C18H32O2/c1-2-4-6-8-10-12-14-18(19-16-17-20-18)15-13-11-9-7-5-3-1/h1-2H,3-17H2/b2-1+.
What are the key properties of (12E)-1,4-dioxaspiro[4.15]icos-12-ene?
(12E)-1,4-dioxaspiro[4.15]icos-12-ene has a molecular weight of 280.45 g/mol, XLogP of 5.37, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (12E)-1,4-dioxaspiro[4.15]icos-12-ene is sourced from PubChem (CID 11357975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).