C18H28O5 — CID 154535606
(3aR,4R,6aR)-4-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane] (PubChem CID 154535606) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is (3aR,4R,6aR)-4-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane].
| Compound Name | (3aR,4R,6aR)-4-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 154535606 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (3aR,4R,6aR)-4-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane] |
| SMILES | C1CCC2(CC1)OC[C@@H]([C@H]1OC[C@H]3OC4(CCCCC4)O[C@@H]13)O2 |
| InChI | InChI=1S/C18H28O5/c1-3-7-17(8-4-1)20-12-14(21-17)15-16-13(11-19-15)22-18(23-16)9-5-2-6-10-18/h13-16H,1-12H2/t13-,14+,15-,16-/m1/s1 |
| InChIKey | GYZCROYFPOLHKL-QKPAOTATSA-N |
| XLogP | 2.91 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |