C18H27NO6 — CID 122524873
(3aR,5S,6S,6aR)-5-(1,4-dioxaspiro[4.5]decan-3-yl)-6-nitrosospiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane] (PubChem CID 122524873) has the molecular formula C18H27NO6 and a molecular weight of 353.42 g/mol. Its IUPAC name is (3aR,5S,6S,6aR)-5-(1,4-dioxaspiro[4.5]decan-3-yl)-6-nitrosospiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane].
| Compound Name | (3aR,5S,6S,6aR)-5-(1,4-dioxaspiro[4.5]decan-3-yl)-6-nitrosospiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 122524873 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (3aR,5S,6S,6aR)-5-(1,4-dioxaspiro[4.5]decan-3-yl)-6-nitrosospiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane] |
| SMILES | O=N[C@@H]1[C@H]2OC3(CCCCC3)O[C@H]2O[C@@H]1C1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C18H27NO6/c20-19-13-14(12-11-21-17(23-12)7-3-1-4-8-17)22-16-15(13)24-18(25-16)9-5-2-6-10-18/h12-16H,1-11H2/t12?,13-,14+,15+,16+/m0/s1 |
| InChIKey | WRRGPMWHTILMKM-GJFSAVBPSA-N |
| XLogP | 3.00 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |