C13H22O5 — CID 101424166
(3S,4R,6S)-6-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]oxane-3,4-diol (PubChem CID 101424166) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is (3S,4R,6S)-6-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]oxane-3,4-diol.
| Compound Name | (3S,4R,6S)-6-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]oxane-3,4-diol |
|---|---|
| PubChem CID | 101424166 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (3S,4R,6S)-6-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]oxane-3,4-diol |
| SMILES | O[C@@H]1C[C@@H]([C@H]2COC3(CCCCC3)O2)OC[C@@H]1O |
| InChI | InChI=1S/C13H22O5/c14-9-6-11(16-7-10(9)15)12-8-17-13(18-12)4-2-1-3-5-13/h9-12,14-15H,1-8H2/t9-,10+,11+,12-/m1/s1 |
| InChIKey | QJEPANGNTCRJAV-NOOOWODRSA-N |
| XLogP | 0.57 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |