C19H26O6S — CID 11101003
[(3R,5S)-5-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]oxolan-3-yl] 4-methylbenzenesulfonate (PubChem CID 11101003) has the molecular formula C19H26O6S and a molecular weight of 382.48 g/mol. Its IUPAC name is [(3R,5S)-5-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]oxolan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3R,5S)-5-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]oxolan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11101003 |
| Molecular Formula | C19H26O6S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | [(3R,5S)-5-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]oxolan-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CO[C@H]([C@H]3COC4(CCCCC4)O3)C2)cc1 |
| InChI | InChI=1S/C19H26O6S/c1-14-5-7-16(8-6-14)26(20,21)25-15-11-17(22-12-15)18-13-23-19(24-18)9-3-2-4-10-19/h5-8,15,17-18H,2-4,9-13H2,1H3/t15-,17+,18-/m1/s1 |
| InChIKey | XDPSAGGEJSBULY-BPQIPLTHSA-N |
| XLogP | 2.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|