N-hydroxy-1,4-dioxaspiro[4.5]decane-3-carboximidoyl chloride

C9H14ClNO3 — CID 72750828

IUPACN-hydroxy-1,4-dioxaspiro[4.5]decane-3-carboximidoyl chloride
SMILESON=C(Cl)C1COC2(CCCCC2)O1
InChIInChI=1S/C9H14ClNO3/c10-8(11-12)7-6-13-9(14-7)4-2-1-3-5-9/h7,12H,1-6H2
InChIKeyFHWDQLCHWMIDCB-UHFFFAOYSA-N
MW219.67 g/mol
LogP2.09
Rot. Bonds1

About N-hydroxy-1,4-dioxaspiro[4.5]decane-3-carboximidoyl chloride

N-hydroxy-1,4-dioxaspiro[4.5]decane-3-carboximidoyl chloride (PubChem CID 72750828) has the molecular formula C9H14ClNO3 and a molecular weight of 219.67 g/mol. Its IUPAC name is N-hydroxy-1,4-dioxaspiro[4.5]decane-3-carboximidoyl chloride.

Molecular Properties

Compound NameN-hydroxy-1,4-dioxaspiro[4.5]decane-3-carboximidoyl chloride
PubChem CID72750828
Molecular FormulaC9H14ClNO3
Molecular Weight219.67 g/mol
Exact Mass219.07
IUPAC NameN-hydroxy-1,4-dioxaspiro[4.5]decane-3-carboximidoyl chloride
SMILESON=C(Cl)C1COC2(CCCCC2)O1
InChIInChI=1S/C9H14ClNO3/c10-8(11-12)7-6-13-9(14-7)4-2-1-3-5-9/h7,12H,1-6H2
InChIKeyFHWDQLCHWMIDCB-UHFFFAOYSA-N
XLogP2.09
TPSA51.05 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.67
LogP ≤ 52.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze N-hydroxy-1,4-dioxaspiro[4.5]decane-3-carboximidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-hydroxy-1,4-dioxaspiro[4.5]decane-3-carboximidoyl chloride?
The IUPAC name of N-hydroxy-1,4-dioxaspiro[4.5]decane-3-carboximidoyl chloride (CID 72750828) is N-hydroxy-1,4-dioxaspiro[4.5]decane-3-carboximidoyl chloride.
What is the SMILES notation for N-hydroxy-1,4-dioxaspiro[4.5]decane-3-carboximidoyl chloride?
The canonical SMILES for N-hydroxy-1,4-dioxaspiro[4.5]decane-3-carboximidoyl chloride is ON=C(Cl)C1COC2(CCCCC2)O1.
What is the InChIKey of N-hydroxy-1,4-dioxaspiro[4.5]decane-3-carboximidoyl chloride?
The InChIKey is FHWDQLCHWMIDCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14ClNO3/c10-8(11-12)7-6-13-9(14-7)4-2-1-3-5-9/h7,12H,1-6H2.
What are the key properties of N-hydroxy-1,4-dioxaspiro[4.5]decane-3-carboximidoyl chloride?
N-hydroxy-1,4-dioxaspiro[4.5]decane-3-carboximidoyl chloride has a molecular weight of 219.67 g/mol, XLogP of 2.09, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-1,4-dioxaspiro[4.5]decane-3-carboximidoyl chloride is sourced from PubChem (CID 72750828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).