C9H14ClNO3 — CID 72750828
N-hydroxy-1,4-dioxaspiro[4.5]decane-3-carboximidoyl chloride (PubChem CID 72750828) has the molecular formula C9H14ClNO3 and a molecular weight of 219.67 g/mol. Its IUPAC name is N-hydroxy-1,4-dioxaspiro[4.5]decane-3-carboximidoyl chloride.
| Compound Name | N-hydroxy-1,4-dioxaspiro[4.5]decane-3-carboximidoyl chloride |
|---|---|
| PubChem CID | 72750828 |
| Molecular Formula | C9H14ClNO3 |
| Molecular Weight | 219.67 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | N-hydroxy-1,4-dioxaspiro[4.5]decane-3-carboximidoyl chloride |
| SMILES | ON=C(Cl)C1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C9H14ClNO3/c10-8(11-12)7-6-13-9(14-7)4-2-1-3-5-9/h7,12H,1-6H2 |
| InChIKey | FHWDQLCHWMIDCB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.67 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|