C8H15BOS — CID 575150
2-ethyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]oxathiaborole (PubChem CID 575150) has the molecular formula C8H15BOS and a molecular weight of 170.09 g/mol. Its IUPAC name is 2-ethyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]oxathiaborole.
| Compound Name | 2-ethyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]oxathiaborole |
|---|---|
| PubChem CID | 575150 |
| Molecular Formula | C8H15BOS |
| Molecular Weight | 170.09 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 2-ethyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]oxathiaborole |
| SMILES | CCB1OC2CCCCC2S1 |
| InChI | InChI=1S/C8H15BOS/c1-2-9-10-7-5-3-4-6-8(7)11-9/h7-8H,2-6H2,1H3 |
| InChIKey | JTJXALROAFYNJW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.09 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|