C16H28S — CID 12574118
9-propyl-2,3,4,4a,5,6,7,8,8a,9,9a,10a-dodecahydro-1H-thioxanthene (PubChem CID 12574118) has the molecular formula C16H28S and a molecular weight of 252.47 g/mol. Its IUPAC name is 9-propyl-2,3,4,4a,5,6,7,8,8a,9,9a,10a-dodecahydro-1H-thioxanthene.
| Compound Name | 9-propyl-2,3,4,4a,5,6,7,8,8a,9,9a,10a-dodecahydro-1H-thioxanthene |
|---|---|
| PubChem CID | 12574118 |
| Molecular Formula | C16H28S |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 9-propyl-2,3,4,4a,5,6,7,8,8a,9,9a,10a-dodecahydro-1H-thioxanthene |
| SMILES | CCCC1C2CCCCC2SC2CCCCC21 |
| InChI | InChI=1S/C16H28S/c1-2-7-12-13-8-3-5-10-15(13)17-16-11-6-4-9-14(12)16/h12-16H,2-11H2,1H3 |
| InChIKey | LYEHHMANYUEENA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |