C17H30 — CID 59963526
9-butyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene (PubChem CID 59963526) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is 9-butyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene.
| Compound Name | 9-butyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene |
|---|---|
| PubChem CID | 59963526 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | 9-butyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene |
| SMILES | CCCCC1C2CCCCC2C2CCCCC12 |
| InChI | InChI=1S/C17H30/c1-2-3-8-13-14-9-4-6-11-16(14)17-12-7-5-10-15(13)17/h13-17H,2-12H2,1H3 |
| InChIKey | RBDSSAFEDDNWJG-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |