C16H26S — CID 166041120
17-thiatetracyclo[8.7.0.03,8.011,16]heptadecane (PubChem CID 166041120) has the molecular formula C16H26S and a molecular weight of 250.45 g/mol. Its IUPAC name is 17-thiatetracyclo[8.7.0.03,8.011,16]heptadecane.
| Compound Name | 17-thiatetracyclo[8.7.0.03,8.011,16]heptadecane |
|---|---|
| PubChem CID | 166041120 |
| Molecular Formula | C16H26S |
| Molecular Weight | 250.45 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 17-thiatetracyclo[8.7.0.03,8.011,16]heptadecane |
| SMILES | C1CCC2CC3C(CC2C1)SC1CCCCC13 |
| InChI | InChI=1S/C16H26S/c1-2-6-12-10-16-14(9-11(12)5-1)13-7-3-4-8-15(13)17-16/h11-16H,1-10H2 |
| InChIKey | HBNYRJSCBYWGDU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |