C11H18S — CID 101020983
(1R,3S,7S,9R)-2-thiatricyclo[7.3.0.03,7]dodecane (PubChem CID 101020983) has the molecular formula C11H18S and a molecular weight of 182.33 g/mol. Its IUPAC name is (1R,3S,7S,9R)-2-thiatricyclo[7.3.0.03,7]dodecane.
| Compound Name | (1R,3S,7S,9R)-2-thiatricyclo[7.3.0.03,7]dodecane |
|---|---|
| PubChem CID | 101020983 |
| Molecular Formula | C11H18S |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (1R,3S,7S,9R)-2-thiatricyclo[7.3.0.03,7]dodecane |
| SMILES | C1C[C@H]2C[C@H]3CCC[C@H]3S[C@H]2C1 |
| InChI | InChI=1S/C11H18S/c1-3-8-7-9-4-2-6-11(9)12-10(8)5-1/h8-11H,1-7H2/t8-,9+,10-,11+ |
| InChIKey | HZZZUXZJXPBGOQ-DTIDVZRVSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |