C7H14BNO2 — CID 142413047
3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxaborol-2-ylmethanamine (PubChem CID 142413047) has the molecular formula C7H14BNO2 and a molecular weight of 155.01 g/mol. Its IUPAC name is 3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxaborol-2-ylmethanamine.
| Compound Name | 3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxaborol-2-ylmethanamine |
|---|---|
| PubChem CID | 142413047 |
| Molecular Formula | C7H14BNO2 |
| Molecular Weight | 155.01 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxaborol-2-ylmethanamine |
| SMILES | NCB1OC2CCCCC2O1 |
| InChI | InChI=1S/C7H14BNO2/c9-5-8-10-6-3-1-2-4-7(6)11-8/h6-7H,1-5,9H2 |
| InChIKey | LSTUTTQPXWVVCY-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.01 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|