C9H17BO2 — CID 156682327
(3aS,6aR)-2-tert-butyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3,2]dioxaborole (PubChem CID 156682327) has the molecular formula C9H17BO2 and a molecular weight of 168.05 g/mol. Its IUPAC name is (3aS,6aR)-2-tert-butyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3,2]dioxaborole.
| Compound Name | (3aS,6aR)-2-tert-butyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3,2]dioxaborole |
|---|---|
| PubChem CID | 156682327 |
| Molecular Formula | C9H17BO2 |
| Molecular Weight | 168.05 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | (3aS,6aR)-2-tert-butyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3,2]dioxaborole |
| SMILES | CC(C)(C)B1O[C@H]2CCC[C@H]2O1 |
| InChI | InChI=1S/C9H17BO2/c1-9(2,3)10-11-7-5-4-6-8(7)12-10/h7-8H,4-6H2,1-3H3/t7-,8+ |
| InChIKey | YSRRNTAFFLYZNX-OCAPTIKFSA-N |
| XLogP | 2.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.05 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|