C18H33BO2 — CID 101234279
(4R,5R)-2-[(2R)-butan-2-yl]-4,5-dicyclohexyl-1,3,2-dioxaborolane (PubChem CID 101234279) has the molecular formula C18H33BO2 and a molecular weight of 292.27 g/mol. Its IUPAC name is (4R,5R)-2-[(2R)-butan-2-yl]-4,5-dicyclohexyl-1,3,2-dioxaborolane.
| Compound Name | (4R,5R)-2-[(2R)-butan-2-yl]-4,5-dicyclohexyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 101234279 |
| Molecular Formula | C18H33BO2 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | (4R,5R)-2-[(2R)-butan-2-yl]-4,5-dicyclohexyl-1,3,2-dioxaborolane |
| SMILES | CC[C@@H](C)B1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C18H33BO2/c1-3-14(2)19-20-17(15-10-6-4-7-11-15)18(21-19)16-12-8-5-9-13-16/h14-18H,3-13H2,1-2H3/t14-,17-,18-/m1/s1 |
| InChIKey | SEWYKJZAWDRXEI-ZTFGCOKTSA-N |
| XLogP | 5.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|