About cyclohexylcyclohexane;diiodomethane
cyclohexylcyclohexane;diiodomethane (PubChem CID 123720179) has the molecular formula C13H24I2
and a molecular weight of 434.14 g/mol. Its IUPAC name is cyclohexylcyclohexane;diiodomethane.
Molecular Properties
| Compound Name | cyclohexylcyclohexane;diiodomethane |
| PubChem CID | 123720179 |
| Molecular Formula | C13H24I2 |
| Molecular Weight | 434.14 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | cyclohexylcyclohexane;diiodomethane |
| SMILES | C1CCC(C2CCCCC2)CC1.ICI |
| InChI | InChI=1S/C12H22.CH2I2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2-1-3/h11-12H,1-10H2;1H2 |
| InChIKey | YPZNTMKWLNSBEA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.14 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylcyclohexane;diiodomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylcyclohexane;diiodomethane?
The IUPAC name of cyclohexylcyclohexane;diiodomethane (CID 123720179) is cyclohexylcyclohexane;diiodomethane.
What is the SMILES notation for cyclohexylcyclohexane;diiodomethane?
The canonical SMILES for cyclohexylcyclohexane;diiodomethane is C1CCC(C2CCCCC2)CC1.ICI.
What is the InChIKey of cyclohexylcyclohexane;diiodomethane?
The InChIKey is YPZNTMKWLNSBEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22.CH2I2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2-1-3/h11-12H,1-10H2;1H2.
What are the key properties of cyclohexylcyclohexane;diiodomethane?
cyclohexylcyclohexane;diiodomethane has a molecular weight of 434.14 g/mol, XLogP of 5.96, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylcyclohexane;diiodomethane is sourced from PubChem (CID 123720179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).