C14H24O — CID 169013366
(2S,3R)-2,3-dicyclohexyloxirane (PubChem CID 169013366) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is (2S,3R)-2,3-dicyclohexyloxirane.
| Compound Name | (2S,3R)-2,3-dicyclohexyloxirane |
|---|---|
| PubChem CID | 169013366 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (2S,3R)-2,3-dicyclohexyloxirane |
| SMILES | C1CCC([C@H]2O[C@H]2C2CCCCC2)CC1 |
| InChI | InChI=1S/C14H24O/c1-3-7-11(8-4-1)13-14(15-13)12-9-5-2-6-10-12/h11-14H,1-10H2/t13-,14+ |
| InChIKey | XATVCQHEABSENL-OKILXGFUSA-N |
| XLogP | 3.91 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|