C14H25O4P — CID 58900627
4,5-dicyclohexyl-2-hydroxy-1,3,2λ5-dioxaphospholane 2-oxide (PubChem CID 58900627) has the molecular formula C14H25O4P and a molecular weight of 288.32 g/mol. Its IUPAC name is 4,5-dicyclohexyl-2-hydroxy-1,3,2λ5-dioxaphospholane 2-oxide.
| Compound Name | 4,5-dicyclohexyl-2-hydroxy-1,3,2λ5-dioxaphospholane 2-oxide |
|---|---|
| PubChem CID | 58900627 |
| Molecular Formula | C14H25O4P |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4,5-dicyclohexyl-2-hydroxy-1,3,2λ5-dioxaphospholane 2-oxide |
| SMILES | O=P1(O)OC(C2CCCCC2)C(C2CCCCC2)O1 |
| InChI | InChI=1S/C14H25O4P/c15-19(16)17-13(11-7-3-1-4-8-11)14(18-19)12-9-5-2-6-10-12/h11-14H,1-10H2,(H,15,16) |
| InChIKey | FFQDUHDEXBKFSN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|