C14H24O3S — CID 139057468
(4S,5R)-4,5-dicyclohexyl-1,3,2-dioxathiolane 2-oxide (PubChem CID 139057468) has the molecular formula C14H24O3S and a molecular weight of 272.41 g/mol. Its IUPAC name is (4S,5R)-4,5-dicyclohexyl-1,3,2-dioxathiolane 2-oxide.
| Compound Name | (4S,5R)-4,5-dicyclohexyl-1,3,2-dioxathiolane 2-oxide |
|---|---|
| PubChem CID | 139057468 |
| Molecular Formula | C14H24O3S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (4S,5R)-4,5-dicyclohexyl-1,3,2-dioxathiolane 2-oxide |
| SMILES | O=S1O[C@H](C2CCCCC2)[C@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C14H24O3S/c15-18-16-13(11-7-3-1-4-8-11)14(17-18)12-9-5-2-6-10-12/h11-14H,1-10H2/t13-,14+,18? |
| InChIKey | MBPVETHJDQIZQA-UUVAVEHKSA-N |
| XLogP | 3.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |